C14H11F3N2 — CID 86021252
N-[(2,2,2-trifluoro-1-phenylethylidene)amino]aniline (PubChem CID 86021252) has the molecular formula C14H11F3N2 and a molecular weight of 264.25 g/mol. Its IUPAC name is N-[(2,2,2-trifluoro-1-phenylethylidene)amino]aniline.
| Compound Name | N-[(2,2,2-trifluoro-1-phenylethylidene)amino]aniline |
|---|---|
| PubChem CID | 86021252 |
| Molecular Formula | C14H11F3N2 |
| Molecular Weight | 264.25 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | N-[(2,2,2-trifluoro-1-phenylethylidene)amino]aniline |
| SMILES | FC(F)(F)C(=NNc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H11F3N2/c15-14(16,17)13(11-7-3-1-4-8-11)19-18-12-9-5-2-6-10-12/h1-10,18H |
| InChIKey | UHAGFVVYDHZPBD-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.25 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|