C8H6BrF3N2 — CID 12914828
(1Z)-2,2,2-trifluoro-N-phenylethanehydrazonoyl bromide (PubChem CID 12914828) has the molecular formula C8H6BrF3N2 and a molecular weight of 267.05 g/mol. Its IUPAC name is (1Z)-2,2,2-trifluoro-N-phenylethanehydrazonoyl bromide.
| Compound Name | (1Z)-2,2,2-trifluoro-N-phenylethanehydrazonoyl bromide |
|---|---|
| PubChem CID | 12914828 |
| Molecular Formula | C8H6BrF3N2 |
| Molecular Weight | 267.05 g/mol |
| Exact Mass | 265.97 |
| IUPAC Name | (1Z)-2,2,2-trifluoro-N-phenylethanehydrazonoyl bromide |
| SMILES | FC(F)(F)/C(Br)=N/Nc1ccccc1 |
| InChI | InChI=1S/C8H6BrF3N2/c9-7(8(10,11)12)14-13-6-4-2-1-3-5-6/h1-5,13H/b14-7- |
| InChIKey | PDJSUNSCSLRYEW-AUWJEWJLSA-N |
| XLogP | 3.37 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.05 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|