C12H13F3N2O2 — CID 72942224
methyl (4Z)-5,5,5-trifluoro-4-(phenylhydrazinylidene)pentanoate (PubChem CID 72942224) has the molecular formula C12H13F3N2O2 and a molecular weight of 274.24 g/mol. Its IUPAC name is methyl (4Z)-5,5,5-trifluoro-4-(phenylhydrazinylidene)pentanoate.
| Compound Name | methyl (4Z)-5,5,5-trifluoro-4-(phenylhydrazinylidene)pentanoate |
|---|---|
| PubChem CID | 72942224 |
| Molecular Formula | C12H13F3N2O2 |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | methyl (4Z)-5,5,5-trifluoro-4-(phenylhydrazinylidene)pentanoate |
| SMILES | COC(=O)CC/C(=N/Nc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C12H13F3N2O2/c1-19-11(18)8-7-10(12(13,14)15)17-16-9-5-3-2-4-6-9/h2-6,16H,7-8H2,1H3/b17-10- |
| InChIKey | VEKMXIUJWWVOMK-YVLHZVERSA-N |
| XLogP | 2.97 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|