C26H23F3N2O2 — CID 10928502
methyl (4E)-4-(9,10-dihydroanthracen-2-yl)-4-[[3-(trifluoromethyl)phenyl]hydrazinylidene]butanoate (PubChem CID 10928502) has the molecular formula C26H23F3N2O2 and a molecular weight of 452.48 g/mol. Its IUPAC name is methyl (4E)-4-(9,10-dihydroanthracen-2-yl)-4-[[3-(trifluoromethyl)phenyl]hydrazinylidene]butanoate.
| Compound Name | methyl (4E)-4-(9,10-dihydroanthracen-2-yl)-4-[[3-(trifluoromethyl)phenyl]hydrazinylidene]butanoate |
|---|---|
| PubChem CID | 10928502 |
| Molecular Formula | C26H23F3N2O2 |
| Molecular Weight | 452.48 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | methyl (4E)-4-(9,10-dihydroanthracen-2-yl)-4-[[3-(trifluoromethyl)phenyl]hydrazinylidene]butanoate |
| SMILES | COC(=O)CC/C(=N\Nc1cccc(C(F)(F)F)c1)c1ccc2c(c1)Cc1ccccc1C2 |
| InChI | InChI=1S/C26H23F3N2O2/c1-33-25(32)12-11-24(31-30-23-8-4-7-22(16-23)26(27,28)29)20-10-9-19-13-17-5-2-3-6-18(17)14-21(19)15-20/h2-10,15-16,30H,11-14H2,1H3/b31-24+ |
| InChIKey | PLGIAARZMSAHIN-QFMPWRQOSA-N |
| XLogP | 5.97 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.48 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|