C17H24N4O4 — CID 3281157
ethyl 2-[[2-[4-(phenylhydrazinylidene)pentanoylamino]acetyl]amino]acetate (PubChem CID 3281157) has the molecular formula C17H24N4O4 and a molecular weight of 348.40 g/mol. Its IUPAC name is ethyl 2-[[2-[4-(phenylhydrazinylidene)pentanoylamino]acetyl]amino]acetate.
| Compound Name | ethyl 2-[[2-[4-(phenylhydrazinylidene)pentanoylamino]acetyl]amino]acetate |
|---|---|
| PubChem CID | 3281157 |
| Molecular Formula | C17H24N4O4 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | ethyl 2-[[2-[4-(phenylhydrazinylidene)pentanoylamino]acetyl]amino]acetate |
| SMILES | CCOC(=O)CNC(=O)CNC(=O)CCC(C)=NNc1ccccc1 |
| InChI | InChI=1S/C17H24N4O4/c1-3-25-17(24)12-19-16(23)11-18-15(22)10-9-13(2)20-21-14-7-5-4-6-8-14/h4-8,21H,3,9-12H2,1-2H3,(H,18,22)(H,19,23) |
| InChIKey | PFNHNZULQYFKJN-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 108.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|