C17H23N3O4 — CID 5368572
ethyl (3E)-3-[[4-(benzylamino)-4-oxobutanoyl]hydrazinylidene]butanoate (PubChem CID 5368572) has the molecular formula C17H23N3O4 and a molecular weight of 333.39 g/mol. Its IUPAC name is ethyl (3E)-3-[[4-(benzylamino)-4-oxobutanoyl]hydrazinylidene]butanoate.
| Compound Name | ethyl (3E)-3-[[4-(benzylamino)-4-oxobutanoyl]hydrazinylidene]butanoate |
|---|---|
| PubChem CID | 5368572 |
| Molecular Formula | C17H23N3O4 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | ethyl (3E)-3-[[4-(benzylamino)-4-oxobutanoyl]hydrazinylidene]butanoate |
| SMILES | CCOC(=O)C/C(C)=N/NC(=O)CCC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C17H23N3O4/c1-3-24-17(23)11-13(2)19-20-16(22)10-9-15(21)18-12-14-7-5-4-6-8-14/h4-8H,3,9-12H2,1-2H3,(H,18,21)(H,20,22)/b19-13+ |
| InChIKey | QNDIBEWFQKOGAH-CPNJWEJPSA-N |
| XLogP | 1.53 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|