About ethyl 3-[(2,2-diphenylacetyl)hydrazinylidene]butanoate
ethyl 3-[(2,2-diphenylacetyl)hydrazinylidene]butanoate (PubChem CID 5235371) has the molecular formula C20H22N2O3
and a molecular weight of 338.41 g/mol. Its IUPAC name is ethyl 3-[(2,2-diphenylacetyl)hydrazinylidene]butanoate.
Molecular Properties
| Compound Name | ethyl 3-[(2,2-diphenylacetyl)hydrazinylidene]butanoate |
| PubChem CID | 5235371 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | ethyl 3-[(2,2-diphenylacetyl)hydrazinylidene]butanoate |
| SMILES | CCOC(=O)CC(C)=NNC(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H22N2O3/c1-3-25-18(23)14-15(2)21-22-20(24)19(16-10-6-4-7-11-16)17-12-8-5-9-13-17/h4-13,19H,3,14H2,1-2H3,(H,22,24) |
| InChIKey | WCJCAOMRKZPHRB-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-[(2,2-diphenylacetyl)hydrazinylidene]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[(2,2-diphenylacetyl)hydrazinylidene]butanoate?
The IUPAC name of ethyl 3-[(2,2-diphenylacetyl)hydrazinylidene]butanoate (CID 5235371) is ethyl 3-[(2,2-diphenylacetyl)hydrazinylidene]butanoate.
What is the SMILES notation for ethyl 3-[(2,2-diphenylacetyl)hydrazinylidene]butanoate?
The canonical SMILES for ethyl 3-[(2,2-diphenylacetyl)hydrazinylidene]butanoate is CCOC(=O)CC(C)=NNC(=O)C(c1ccccc1)c1ccccc1.
What is the InChIKey of ethyl 3-[(2,2-diphenylacetyl)hydrazinylidene]butanoate?
The InChIKey is WCJCAOMRKZPHRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N2O3/c1-3-25-18(23)14-15(2)21-22-20(24)19(16-10-6-4-7-11-16)17-12-8-5-9-13-17/h4-13,19H,3,14H2,1-2H3,(H,22,24).
What are the key properties of ethyl 3-[(2,2-diphenylacetyl)hydrazinylidene]butanoate?
ethyl 3-[(2,2-diphenylacetyl)hydrazinylidene]butanoate has a molecular weight of 338.41 g/mol, XLogP of 3.26, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[(2,2-diphenylacetyl)hydrazinylidene]butanoate is sourced from PubChem (CID 5235371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).