C21H26N2O — CID 54785044
N-[(E)-heptan-3-ylideneamino]-2,2-diphenylacetamide (PubChem CID 54785044) has the molecular formula C21H26N2O and a molecular weight of 322.45 g/mol. Its IUPAC name is N-[(E)-heptan-3-ylideneamino]-2,2-diphenylacetamide.
| Compound Name | N-[(E)-heptan-3-ylideneamino]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 54785044 |
| Molecular Formula | C21H26N2O |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | N-[(E)-heptan-3-ylideneamino]-2,2-diphenylacetamide |
| SMILES | CCCC/C(CC)=N/NC(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H26N2O/c1-3-5-16-19(4-2)22-23-21(24)20(17-12-8-6-9-13-17)18-14-10-7-11-15-18/h6-15,20H,3-5,16H2,1-2H3,(H,23,24)/b22-19+ |
| InChIKey | YGMMZKRQGXGKBP-ZBJSNUHESA-N |
| XLogP | 4.89 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|