C22H26N2O2 — CID 59032300
9H-fluoren-9-ylmethyl N-[(Z)-heptan-3-ylideneamino]carbamate (PubChem CID 59032300) has the molecular formula C22H26N2O2 and a molecular weight of 350.46 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[(Z)-heptan-3-ylideneamino]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[(Z)-heptan-3-ylideneamino]carbamate |
|---|---|
| PubChem CID | 59032300 |
| Molecular Formula | C22H26N2O2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[(Z)-heptan-3-ylideneamino]carbamate |
| SMILES | CCCC/C(CC)=N\NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C22H26N2O2/c1-3-5-10-16(4-2)23-24-22(25)26-15-21-19-13-8-6-11-17(19)18-12-7-9-14-20(18)21/h6-9,11-14,21H,3-5,10,15H2,1-2H3,(H,24,25)/b23-16- |
| InChIKey | GFUSUGCULHYAMV-KQWNVCNZSA-N |
| XLogP | 5.48 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|