C12H12F3N3O4 — CID 72942205
methyl (4Z)-5,5,5-trifluoro-4-[(4-nitrophenyl)hydrazinylidene]pentanoate (PubChem CID 72942205) has the molecular formula C12H12F3N3O4 and a molecular weight of 319.24 g/mol. Its IUPAC name is methyl (4Z)-5,5,5-trifluoro-4-[(4-nitrophenyl)hydrazinylidene]pentanoate.
| Compound Name | methyl (4Z)-5,5,5-trifluoro-4-[(4-nitrophenyl)hydrazinylidene]pentanoate |
|---|---|
| PubChem CID | 72942205 |
| Molecular Formula | C12H12F3N3O4 |
| Molecular Weight | 319.24 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | methyl (4Z)-5,5,5-trifluoro-4-[(4-nitrophenyl)hydrazinylidene]pentanoate |
| SMILES | COC(=O)CC/C(=N/Nc1ccc([N+](=O)[O-])cc1)C(F)(F)F |
| InChI | InChI=1S/C12H12F3N3O4/c1-22-11(19)7-6-10(12(13,14)15)17-16-8-2-4-9(5-3-8)18(20)21/h2-5,16H,6-7H2,1H3/b17-10- |
| InChIKey | VZEJMKQCFQPIAP-YVLHZVERSA-N |
| XLogP | 2.88 |
| TPSA | 93.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.24 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|