C7H4BrClF3N3 — CID 134102990
(1Z)-N-(4-chloro-2-pyridinyl)-2,2,2-trifluoroethanehydrazonoyl bromide (PubChem CID 134102990) has the molecular formula C7H4BrClF3N3 and a molecular weight of 302.48 g/mol. Its IUPAC name is (1Z)-N-(4-chloro-2-pyridinyl)-2,2,2-trifluoroethanehydrazonoyl bromide.
| Compound Name | (1Z)-N-(4-chloro-2-pyridinyl)-2,2,2-trifluoroethanehydrazonoyl bromide |
|---|---|
| PubChem CID | 134102990 |
| Molecular Formula | C7H4BrClF3N3 |
| Molecular Weight | 302.48 g/mol |
| Exact Mass | 300.92 |
| IUPAC Name | (1Z)-N-(4-chloro-2-pyridinyl)-2,2,2-trifluoroethanehydrazonoyl bromide |
| SMILES | FC(F)(F)/C(Br)=N/Nc1cc(Cl)ccn1 |
| InChI | InChI=1S/C7H4BrClF3N3/c8-6(7(10,11)12)15-14-5-3-4(9)1-2-13-5/h1-3H,(H,13,14)/b15-6- |
| InChIKey | RIVAQFINADFYDP-UUASQNMZSA-N |
| XLogP | 3.42 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.48 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|