C11H17ClN2O — CID 153392299
4-chloro-N-methylpyridin-2-amine;2,2-dimethylpropanal (PubChem CID 153392299) has the molecular formula C11H17ClN2O and a molecular weight of 228.72 g/mol. Its IUPAC name is 4-chloro-N-methylpyridin-2-amine;2,2-dimethylpropanal.
| Compound Name | 4-chloro-N-methylpyridin-2-amine;2,2-dimethylpropanal |
|---|---|
| PubChem CID | 153392299 |
| Molecular Formula | C11H17ClN2O |
| Molecular Weight | 228.72 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 4-chloro-N-methylpyridin-2-amine;2,2-dimethylpropanal |
| SMILES | CC(C)(C)C=O.CNc1cc(Cl)ccn1 |
| InChI | InChI=1S/C6H7ClN2.C5H10O/c1-8-6-4-5(7)2-3-9-6;1-5(2,3)4-6/h2-4H,1H3,(H,8,9);4H,1-3H3 |
| InChIKey | RZCJQNJDUSYXRQ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.72 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|