C13H19ClN2O4 — CID 161046296
tert-butyl N-(4-chloro-2-pyridinyl)carbamate;ethyl formate (PubChem CID 161046296) has the molecular formula C13H19ClN2O4 and a molecular weight of 302.76 g/mol. Its IUPAC name is tert-butyl N-(4-chloro-2-pyridinyl)carbamate;ethyl formate.
| Compound Name | tert-butyl N-(4-chloro-2-pyridinyl)carbamate;ethyl formate |
|---|---|
| PubChem CID | 161046296 |
| Molecular Formula | C13H19ClN2O4 |
| Molecular Weight | 302.76 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | tert-butyl N-(4-chloro-2-pyridinyl)carbamate;ethyl formate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(Cl)ccn1.CCOC=O |
| InChI | InChI=1S/C10H13ClN2O2.C3H6O2/c1-10(2,3)15-9(14)13-8-6-7(11)4-5-12-8;1-2-5-3-4/h4-6H,1-3H3,(H,12,13,14);3H,2H2,1H3 |
| InChIKey | UBNQYHPJDFHZNP-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.76 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|