C16H22N2O4 — CID 165379044
ethyl (E)-3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-pyridinyl]but-2-enoate (PubChem CID 165379044) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is ethyl (E)-3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-pyridinyl]but-2-enoate.
| Compound Name | ethyl (E)-3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-pyridinyl]but-2-enoate |
|---|---|
| PubChem CID | 165379044 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | ethyl (E)-3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-pyridinyl]but-2-enoate |
| SMILES | CCOC(=O)/C=C(\C)c1ccnc(NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C16H22N2O4/c1-6-21-14(19)9-11(2)12-7-8-17-13(10-12)18-15(20)22-16(3,4)5/h7-10H,6H2,1-5H3,(H,17,18,20)/b11-9+ |
| InChIKey | DBCBJPCLNKFTQF-PKNBQFBNSA-N |
| XLogP | 3.39 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|