C21H24FN3O3 — CID 140501047
tert-butyl N-[4-[(E)-1-(dimethylamino)-3-(4-fluorophenyl)-3-oxoprop-1-en-2-yl]-2-pyridinyl]carbamate (PubChem CID 140501047) has the molecular formula C21H24FN3O3 and a molecular weight of 385.44 g/mol. Its IUPAC name is tert-butyl N-[4-[(E)-1-(dimethylamino)-3-(4-fluorophenyl)-3-oxoprop-1-en-2-yl]-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[4-[(E)-1-(dimethylamino)-3-(4-fluorophenyl)-3-oxoprop-1-en-2-yl]-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 140501047 |
| Molecular Formula | C21H24FN3O3 |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | tert-butyl N-[4-[(E)-1-(dimethylamino)-3-(4-fluorophenyl)-3-oxoprop-1-en-2-yl]-2-pyridinyl]carbamate |
| SMILES | CN(C)/C=C(/C(=O)c1ccc(F)cc1)c1ccnc(NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C21H24FN3O3/c1-21(2,3)28-20(27)24-18-12-15(10-11-23-18)17(13-25(4)5)19(26)14-6-8-16(22)9-7-14/h6-13H,1-5H3,(H,23,24,27)/b17-13+ |
| InChIKey | PLZLYWWYVYOXEU-GHRIWEEISA-N |
| XLogP | 4.35 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|