C10H13ClN2O2 — CID 115626770
N-(4-chloro-2-pyridinyl)-3-ethoxypropanamide (PubChem CID 115626770) has the molecular formula C10H13ClN2O2 and a molecular weight of 228.68 g/mol. Its IUPAC name is N-(4-chloro-2-pyridinyl)-3-ethoxypropanamide.
| Compound Name | N-(4-chloro-2-pyridinyl)-3-ethoxypropanamide |
|---|---|
| PubChem CID | 115626770 |
| Molecular Formula | C10H13ClN2O2 |
| Molecular Weight | 228.68 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | N-(4-chloro-2-pyridinyl)-3-ethoxypropanamide |
| SMILES | CCOCCC(=O)Nc1cc(Cl)ccn1 |
| InChI | InChI=1S/C10H13ClN2O2/c1-2-15-6-4-10(14)13-9-7-8(11)3-5-12-9/h3,5,7H,2,4,6H2,1H3,(H,12,13,14) |
| InChIKey | WURLCJUSCYIRID-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.68 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|