C13H20N2 — CID 14914436
N-[(E)-4,4-dimethylpentan-2-ylideneamino]aniline (PubChem CID 14914436) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is N-[(E)-4,4-dimethylpentan-2-ylideneamino]aniline.
| Compound Name | N-[(E)-4,4-dimethylpentan-2-ylideneamino]aniline |
|---|---|
| PubChem CID | 14914436 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | N-[(E)-4,4-dimethylpentan-2-ylideneamino]aniline |
| SMILES | C/C(CC(C)(C)C)=N\Nc1ccccc1 |
| InChI | InChI=1S/C13H20N2/c1-11(10-13(2,3)4)14-15-12-8-6-5-7-9-12/h5-9,15H,10H2,1-4H3/b14-11+ |
| InChIKey | SDQXVNXAIAWFTR-SDNWHVSQSA-N |
| XLogP | 3.91 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|