C14H20N2 — CID 177464086
N-[(E)-[(E)-oct-6-en-2-ylidene]amino]aniline (PubChem CID 177464086) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is N-[(E)-[(E)-oct-6-en-2-ylidene]amino]aniline.
| Compound Name | N-[(E)-[(E)-oct-6-en-2-ylidene]amino]aniline |
|---|---|
| PubChem CID | 177464086 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | N-[(E)-[(E)-oct-6-en-2-ylidene]amino]aniline |
| SMILES | C/C=C/CCC/C(C)=N/Nc1ccccc1 |
| InChI | InChI=1S/C14H20N2/c1-3-4-5-7-10-13(2)15-16-14-11-8-6-9-12-14/h3-4,6,8-9,11-12,16H,5,7,10H2,1-2H3/b4-3+,15-13+ |
| InChIKey | GTNDQYYBSNIAOQ-CVQZUKTBSA-N |
| XLogP | 4.22 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|