C16H22F3N — CID 102263374
2,2,2-trifluoro-N-octyl-1-phenylethanimine (PubChem CID 102263374) has the molecular formula C16H22F3N and a molecular weight of 285.35 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-octyl-1-phenylethanimine.
| Compound Name | 2,2,2-trifluoro-N-octyl-1-phenylethanimine |
|---|---|
| PubChem CID | 102263374 |
| Molecular Formula | C16H22F3N |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 2,2,2-trifluoro-N-octyl-1-phenylethanimine |
| SMILES | CCCCCCCC/N=C(\c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C16H22F3N/c1-2-3-4-5-6-10-13-20-15(16(17,18)19)14-11-8-7-9-12-14/h7-9,11-12H,2-6,10,13H2,1H3/b20-15+ |
| InChIKey | MHGANPMVBUXPLV-HMMYKYKNSA-N |
| XLogP | 5.40 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|