C19H24N2O2S — CID 3787959
N-(benzenesulfonyl)-N'-hexylbenzenecarboximidamide (PubChem CID 3787959) has the molecular formula C19H24N2O2S and a molecular weight of 344.48 g/mol. Its IUPAC name is N-(benzenesulfonyl)-N'-hexylbenzenecarboximidamide.
| Compound Name | N-(benzenesulfonyl)-N'-hexylbenzenecarboximidamide |
|---|---|
| PubChem CID | 3787959 |
| Molecular Formula | C19H24N2O2S |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | N-(benzenesulfonyl)-N'-hexylbenzenecarboximidamide |
| SMILES | CCCCCC/N=C(/NS(=O)(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H24N2O2S/c1-2-3-4-11-16-20-19(17-12-7-5-8-13-17)21-24(22,23)18-14-9-6-10-15-18/h5-10,12-15H,2-4,11,16H2,1H3,(H,20,21) |
| InChIKey | IYRPOKFCODWZQU-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|