C12H13F3KNO2 — CID 143181605
potassium;ethane;2-[(2,2,2-trifluoro-1-phenylethylidene)amino]acetate (PubChem CID 143181605) has the molecular formula C12H13F3KNO2 and a molecular weight of 299.33 g/mol. Its IUPAC name is potassium;ethane;2-[(2,2,2-trifluoro-1-phenylethylidene)amino]acetate.
| Compound Name | potassium;ethane;2-[(2,2,2-trifluoro-1-phenylethylidene)amino]acetate |
|---|---|
| PubChem CID | 143181605 |
| Molecular Formula | C12H13F3KNO2 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | potassium;ethane;2-[(2,2,2-trifluoro-1-phenylethylidene)amino]acetate |
| SMILES | CC.O=C([O-])C/N=C(\c1ccccc1)C(F)(F)F.[K+] |
| InChI | InChI=1S/C10H8F3NO2.C2H6.K/c11-10(12,13)9(14-6-8(15)16)7-4-2-1-3-5-7;1-2;/h1-5H,6H2,(H,15,16);1-2H3;/q;;+1/p-1/b14-9+;; |
| InChIKey | IKKLVWBLOXFDCB-CAJRCRMVSA-M |
| XLogP | -1.18 |
| TPSA | 52.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|