C14H17F7N4O2Si — CID 177496858
[[(E)-N-(dimethylamino)-C-(trifluoromethyl)carbonimidoyl]oxy-fluoro-phenylsilyl] (1E)-2,2,2-trifluoro-N,N-dimethylethanehydrazonate (PubChem CID 177496858) has the molecular formula C14H17F7N4O2Si and a molecular weight of 434.39 g/mol. Its IUPAC name is [[(E)-N-(dimethylamino)-C-(trifluoromethyl)carbonimidoyl]oxy-fluoro-phenylsilyl] (1E)-2,2,2-trifluoro-N,N-dimethylethanehydrazonate.
| Compound Name | [[(E)-N-(dimethylamino)-C-(trifluoromethyl)carbonimidoyl]oxy-fluoro-phenylsilyl] (1E)-2,2,2-trifluoro-N,N-dimethylethanehydrazonate |
|---|---|
| PubChem CID | 177496858 |
| Molecular Formula | C14H17F7N4O2Si |
| Molecular Weight | 434.39 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | [[(E)-N-(dimethylamino)-C-(trifluoromethyl)carbonimidoyl]oxy-fluoro-phenylsilyl] (1E)-2,2,2-trifluoro-N,N-dimethylethanehydrazonate |
| SMILES | CN(C)/N=C(/O[Si](F)(O/C(=N/N(C)C)C(F)(F)F)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C14H17F7N4O2Si/c1-24(2)22-11(13(15,16)17)26-28(21,10-8-6-5-7-9-10)27-12(14(18,19)20)23-25(3)4/h5-9H,1-4H3/b22-11+,23-12+ |
| InChIKey | KEFKCXCMQYMLQN-LCHFAGMQSA-N |
| XLogP | 2.71 |
| TPSA | 49.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.39 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|