C21H24F3N3O3 — CID 135804131
2,4-ditert-butyl-6-[[2-nitro-4-(trifluoromethyl)phenyl]diazenyl]phenol (PubChem CID 135804131) has the molecular formula C21H24F3N3O3 and a molecular weight of 423.44 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[[2-nitro-4-(trifluoromethyl)phenyl]diazenyl]phenol.
| Compound Name | 2,4-ditert-butyl-6-[[2-nitro-4-(trifluoromethyl)phenyl]diazenyl]phenol |
|---|---|
| PubChem CID | 135804131 |
| Molecular Formula | C21H24F3N3O3 |
| Molecular Weight | 423.44 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 2,4-ditert-butyl-6-[[2-nitro-4-(trifluoromethyl)phenyl]diazenyl]phenol |
| SMILES | CC(C)(C)c1cc(/N=N/c2ccc(C(F)(F)F)cc2[N+](=O)[O-])c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C21H24F3N3O3/c1-19(2,3)13-9-14(20(4,5)6)18(28)16(10-13)26-25-15-8-7-12(21(22,23)24)11-17(15)27(29)30/h7-11,28H,1-6H3/b26-25+ |
| InChIKey | VLKLKMFZBGODJH-OCEACIFDSA-N |
| XLogP | 7.33 |
| TPSA | 88.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.44 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|