C37H35N3O3 — CID 135708769
2-[(4-benzyl-2-nitrophenyl)diazenyl]-4,6-bis(2-phenylpropan-2-yl)phenol (PubChem CID 135708769) has the molecular formula C37H35N3O3 and a molecular weight of 569.71 g/mol. Its IUPAC name is 2-[(4-benzyl-2-nitrophenyl)diazenyl]-4,6-bis(2-phenylpropan-2-yl)phenol.
| Compound Name | 2-[(4-benzyl-2-nitrophenyl)diazenyl]-4,6-bis(2-phenylpropan-2-yl)phenol |
|---|---|
| PubChem CID | 135708769 |
| Molecular Formula | C37H35N3O3 |
| Molecular Weight | 569.71 g/mol |
| Exact Mass | 569.27 |
| IUPAC Name | 2-[(4-benzyl-2-nitrophenyl)diazenyl]-4,6-bis(2-phenylpropan-2-yl)phenol |
| SMILES | CC(C)(c1ccccc1)c1cc(/N=N/c2ccc(Cc3ccccc3)cc2[N+](=O)[O-])c(O)c(C(C)(C)c2ccccc2)c1 |
| InChI | InChI=1S/C37H35N3O3/c1-36(2,28-16-10-6-11-17-28)30-24-31(37(3,4)29-18-12-7-13-19-29)35(41)33(25-30)39-38-32-21-20-27(23-34(32)40(42)43)22-26-14-8-5-9-15-26/h5-21,23-25,41H,22H2,1-4H3/b39-38+ |
| InChIKey | FGPDDEZMCPODEC-YMZYAJTMSA-N |
| XLogP | 9.96 |
| TPSA | 88.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.71 |
| LogP ≤ 5 | 9.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|