C27H22 — CID 144983528
9-cyclohexa-1,5-dien-3-yn-1-yl-9-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]fluorene (PubChem CID 144983528) has the molecular formula C27H22 and a molecular weight of 346.47 g/mol. Its IUPAC name is 9-cyclohexa-1,5-dien-3-yn-1-yl-9-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]fluorene.
| Compound Name | 9-cyclohexa-1,5-dien-3-yn-1-yl-9-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]fluorene |
|---|---|
| PubChem CID | 144983528 |
| Molecular Formula | C27H22 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 9-cyclohexa-1,5-dien-3-yn-1-yl-9-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]fluorene |
| SMILES | C/C=C\C=C(/C=C\C)C1(c2cc#ccc2)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C27H22/c1-3-5-14-21(13-4-2)27(22-15-7-6-8-16-22)25-19-11-9-17-23(25)24-18-10-12-20-26(24)27/h3-5,7,9-20H,1-2H3/b5-3-,13-4-,21-14+ |
| InChIKey | SOLSNYFPIFTOSO-AGDHUJPBSA-N |
| XLogP | 6.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|