C44H38N2 — CID 144815980
9-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-N-[4-[(3Z)-5-iminopenta-1,3-dien-2-yl]phenyl]-N-(4-methylphenyl)-9-phenylfluoren-2-amine (PubChem CID 144815980) has the molecular formula C44H38N2 and a molecular weight of 594.80 g/mol. Its IUPAC name is 9-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-N-[4-[(3Z)-5-iminopenta-1,3-dien-2-yl]phenyl]-N-(4-methylphenyl)-9-phenylfluoren-2-amine.
| Compound Name | 9-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-N-[4-[(3Z)-5-iminopenta-1,3-dien-2-yl]phenyl]-N-(4-methylphenyl)-9-phenylfluoren-2-amine |
|---|---|
| PubChem CID | 144815980 |
| Molecular Formula | C44H38N2 |
| Molecular Weight | 594.80 g/mol |
| Exact Mass | 594.30 |
| IUPAC Name | 9-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-N-[4-[(3Z)-5-iminopenta-1,3-dien-2-yl]phenyl]-N-(4-methylphenyl)-9-phenylfluoren-2-amine |
| SMILES | [H]/N=C/C=C\C(=C)c1ccc(N(c2ccc(C)cc2)c2ccc3c(c2)C(/C(C=C)=C/C=C\C)(c2ccccc2)c2ccccc2-3)cc1 |
| InChI | InChI=1S/C44H38N2/c1-5-7-15-35(6-2)44(36-16-9-8-10-17-36)42-19-12-11-18-40(42)41-29-28-39(31-43(41)44)46(37-24-20-32(3)21-25-37)38-26-22-34(23-27-38)33(4)14-13-30-45/h5-31,45H,2,4H2,1,3H3/b7-5-,14-13-,35-15+,45-30+ |
| InChIKey | JSGIQCZGOXGHET-AFMGJWFSSA-N |
| XLogP | 11.69 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.80 |
| LogP ≤ 5 | 11.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|