C41H32 — CID 145303073
13-cyclohepta-1,3,4,6-tetraen-1-yl-1-[(3E,5Z)-hepta-3,5-dien-1-yn-3-yl]-13-[(3E,5Z)-hepta-1,3,5-trien-4-yl]pentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8(20),9,11,14,16,18-nonaene (PubChem CID 145303073) has the molecular formula C41H32 and a molecular weight of 524.71 g/mol. Its IUPAC name is 13-cyclohepta-1,3,4,6-tetraen-1-yl-1-[(3E,5Z)-hepta-3,5-dien-1-yn-3-yl]-13-[(3E,5Z)-hepta-1,3,5-trien-4-yl]pentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8(20),9,11,14,16,18-nonaene.
| Compound Name | 13-cyclohepta-1,3,4,6-tetraen-1-yl-1-[(3E,5Z)-hepta-3,5-dien-1-yn-3-yl]-13-[(3E,5Z)-hepta-1,3,5-trien-4-yl]pentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8(20),9,11,14,16,18-nonaene |
|---|---|
| PubChem CID | 145303073 |
| Molecular Formula | C41H32 |
| Molecular Weight | 524.71 g/mol |
| Exact Mass | 524.25 |
| IUPAC Name | 13-cyclohepta-1,3,4,6-tetraen-1-yl-1-[(3E,5Z)-hepta-3,5-dien-1-yn-3-yl]-13-[(3E,5Z)-hepta-1,3,5-trien-4-yl]pentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8(20),9,11,14,16,18-nonaene |
| SMILES | C#C/C(=C\C=C/C)C12c3ccccc3-c3cccc(c31)C(C1=CC=C=CC=C1)(C(/C=C\C)=C/C=C)c1ccccc12 |
| InChI | InChI=1S/C41H32/c1-5-9-21-30(8-4)41-35-26-15-14-24-33(35)34-25-18-29-38(39(34)41)40(31(19-6-2)20-7-3,32-22-12-10-11-13-23-32)36-27-16-17-28-37(36)41/h4-7,9-10,12-29H,2H2,1,3H3/b9-5-,20-7-,30-21+,31-19+ |
| InChIKey | ZPCRDQRHRXISQN-RYHVXZGQSA-N |
| XLogP | 9.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.71 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|