C27H23NO2 — CID 89296583
3-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-3-(4-hydroxyphenyl)-2-phenylisoindol-1-one (PubChem CID 89296583) has the molecular formula C27H23NO2 and a molecular weight of 393.49 g/mol. Its IUPAC name is 3-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-3-(4-hydroxyphenyl)-2-phenylisoindol-1-one.
| Compound Name | 3-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-3-(4-hydroxyphenyl)-2-phenylisoindol-1-one |
|---|---|
| PubChem CID | 89296583 |
| Molecular Formula | C27H23NO2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 3-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-3-(4-hydroxyphenyl)-2-phenylisoindol-1-one |
| SMILES | C=C/C=C\C=C(/C)C1(c2ccc(O)cc2)c2ccccc2C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C27H23NO2/c1-3-4-6-11-20(2)27(21-16-18-23(29)19-17-21)25-15-10-9-14-24(25)26(30)28(27)22-12-7-5-8-13-22/h3-19,29H,1H2,2H3/b6-4-,20-11+ |
| InChIKey | ACANIZGWQBBWHM-NHULCNMHSA-N |
| XLogP | 5.98 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|