C19H21NO2 — CID 145348908
(3Z,5Z)-4-ethenylhepta-1,3,5-triene;2-ethylisoindole-1,3-dione (PubChem CID 145348908) has the molecular formula C19H21NO2 and a molecular weight of 295.38 g/mol. Its IUPAC name is (3Z,5Z)-4-ethenylhepta-1,3,5-triene;2-ethylisoindole-1,3-dione.
| Compound Name | (3Z,5Z)-4-ethenylhepta-1,3,5-triene;2-ethylisoindole-1,3-dione |
|---|---|
| PubChem CID | 145348908 |
| Molecular Formula | C19H21NO2 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | (3Z,5Z)-4-ethenylhepta-1,3,5-triene;2-ethylisoindole-1,3-dione |
| SMILES | C=C/C=C(C=C)\C=C/C.CCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C10H9NO2.C9H12/c1-2-11-9(12)7-5-3-4-6-8(7)10(11)13;1-4-7-9(6-3)8-5-2/h3-6H,2H2,1H3;4-8H,1,3H2,2H3/b;8-5-,9-7- |
| InChIKey | GOWUFUBIFXZHDR-KLDAKGPYSA-N |
| XLogP | 4.16 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|