C18H22N2O3 — CID 159094001
2-methylidenebut-3-en-1-amine;2-(2-methylidenebut-3-enyl)isoindole-1,3-dione;hydrate (PubChem CID 159094001) has the molecular formula C18H22N2O3 and a molecular weight of 314.39 g/mol. Its IUPAC name is 2-methylidenebut-3-en-1-amine;2-(2-methylidenebut-3-enyl)isoindole-1,3-dione;hydrate.
| Compound Name | 2-methylidenebut-3-en-1-amine;2-(2-methylidenebut-3-enyl)isoindole-1,3-dione;hydrate |
|---|---|
| PubChem CID | 159094001 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 2-methylidenebut-3-en-1-amine;2-(2-methylidenebut-3-enyl)isoindole-1,3-dione;hydrate |
| SMILES | C=CC(=C)CN.C=CC(=C)CN1C(=O)c2ccccc2C1=O.O |
| InChI | InChI=1S/C13H11NO2.C5H9N.H2O/c1-3-9(2)8-14-12(15)10-6-4-5-7-11(10)13(14)16;1-3-5(2)4-6;/h3-7H,1-2,8H2;3H,1-2,4,6H2;1H2 |
| InChIKey | FRFQHJVOADQDBH-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 94.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|