About 2-ethenylisoindole-1,3-dione;prop-2-en-1-amine
2-ethenylisoindole-1,3-dione;prop-2-en-1-amine (PubChem CID 21271999) has the molecular formula C13H14N2O2
and a molecular weight of 230.27 g/mol. Its IUPAC name is 2-ethenylisoindole-1,3-dione;prop-2-en-1-amine.
Molecular Properties
| Compound Name | 2-ethenylisoindole-1,3-dione;prop-2-en-1-amine |
| PubChem CID | 21271999 |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 2-ethenylisoindole-1,3-dione;prop-2-en-1-amine |
| SMILES | C=CCN.C=CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C10H7NO2.C3H7N/c1-2-11-9(12)7-5-3-4-6-8(7)10(11)13;1-2-3-4/h2-6H,1H2;2H,1,3-4H2 |
| InChIKey | YLRPNXMETRTMEI-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-ethenylisoindole-1,3-dione;prop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenylisoindole-1,3-dione;prop-2-en-1-amine?
The IUPAC name of 2-ethenylisoindole-1,3-dione;prop-2-en-1-amine (CID 21271999) is 2-ethenylisoindole-1,3-dione;prop-2-en-1-amine.
What is the SMILES notation for 2-ethenylisoindole-1,3-dione;prop-2-en-1-amine?
The canonical SMILES for 2-ethenylisoindole-1,3-dione;prop-2-en-1-amine is C=CCN.C=CN1C(=O)c2ccccc2C1=O.
What is the InChIKey of 2-ethenylisoindole-1,3-dione;prop-2-en-1-amine?
The InChIKey is YLRPNXMETRTMEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NO2.C3H7N/c1-2-11-9(12)7-5-3-4-6-8(7)10(11)13;1-2-3-4/h2-6H,1H2;2H,1,3-4H2.
What are the key properties of 2-ethenylisoindole-1,3-dione;prop-2-en-1-amine?
2-ethenylisoindole-1,3-dione;prop-2-en-1-amine has a molecular weight of 230.27 g/mol, XLogP of 1.56, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenylisoindole-1,3-dione;prop-2-en-1-amine is sourced from PubChem (CID 21271999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).