C14H14N2O3 — CID 101103152
(2S)-2-(1,3-dioxoisoindol-2-yl)-2-methylpent-4-enamide (PubChem CID 101103152) has the molecular formula C14H14N2O3 and a molecular weight of 258.28 g/mol. Its IUPAC name is (2S)-2-(1,3-dioxoisoindol-2-yl)-2-methylpent-4-enamide.
| Compound Name | (2S)-2-(1,3-dioxoisoindol-2-yl)-2-methylpent-4-enamide |
|---|---|
| PubChem CID | 101103152 |
| Molecular Formula | C14H14N2O3 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | (2S)-2-(1,3-dioxoisoindol-2-yl)-2-methylpent-4-enamide |
| SMILES | C=CC[C@@](C)(C(N)=O)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C14H14N2O3/c1-3-8-14(2,13(15)19)16-11(17)9-6-4-5-7-10(9)12(16)18/h3-7H,1,8H2,2H3,(H2,15,19)/t14-/m0/s1 |
| InChIKey | FLSSLLSKRSWDDL-AWEZNQCLSA-N |
| XLogP | 1.10 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|