C10H7NO5S — CID 87729885
2-ethenyl-1,3-dioxoisoindole-4-sulfonic acid (PubChem CID 87729885) has the molecular formula C10H7NO5S and a molecular weight of 253.23 g/mol. Its IUPAC name is 2-ethenyl-1,3-dioxoisoindole-4-sulfonic acid.
| Compound Name | 2-ethenyl-1,3-dioxoisoindole-4-sulfonic acid |
|---|---|
| PubChem CID | 87729885 |
| Molecular Formula | C10H7NO5S |
| Molecular Weight | 253.23 g/mol |
| Exact Mass | 253.00 |
| IUPAC Name | 2-ethenyl-1,3-dioxoisoindole-4-sulfonic acid |
| SMILES | C=CN1C(=O)c2cccc(S(=O)(=O)O)c2C1=O |
| InChI | InChI=1S/C10H7NO5S/c1-2-11-9(12)6-4-3-5-7(17(14,15)16)8(6)10(11)13/h2-5H,1H2,(H,14,15,16) |
| InChIKey | LUXYHQLKOYCGSM-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.23 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|