About potassium 2-(1,3-dioxoisoindol-2-yl)ethanesulfonate
potassium 2-(1,3-dioxoisoindol-2-yl)ethanesulfonate (PubChem CID 22960477) has the molecular formula C10H8KNO5S
and a molecular weight of 293.34 g/mol. Its IUPAC name is potassium 2-(1,3-dioxoisoindol-2-yl)ethanesulfonate.
Molecular Properties
| Compound Name | potassium 2-(1,3-dioxoisoindol-2-yl)ethanesulfonate |
| PubChem CID | 22960477 |
| Molecular Formula | C10H8KNO5S |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 292.98 |
| IUPAC Name | potassium 2-(1,3-dioxoisoindol-2-yl)ethanesulfonate |
| SMILES | O=C1c2ccccc2C(=O)N1CCS(=O)(=O)[O-].[K+] |
| InChI | InChI=1S/C10H9NO5S.K/c12-9-7-3-1-2-4-8(7)10(13)11(9)5-6-17(14,15)16;/h1-4H,5-6H2,(H,14,15,16);/q;+1/p-1 |
| InChIKey | UHZPGGARCNRPBD-UHFFFAOYSA-M |
| XLogP | -3.17 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | -3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze potassium 2-(1,3-dioxoisoindol-2-yl)ethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 2-(1,3-dioxoisoindol-2-yl)ethanesulfonate?
The IUPAC name of potassium 2-(1,3-dioxoisoindol-2-yl)ethanesulfonate (CID 22960477) is potassium 2-(1,3-dioxoisoindol-2-yl)ethanesulfonate.
What is the SMILES notation for potassium 2-(1,3-dioxoisoindol-2-yl)ethanesulfonate?
The canonical SMILES for potassium 2-(1,3-dioxoisoindol-2-yl)ethanesulfonate is O=C1c2ccccc2C(=O)N1CCS(=O)(=O)[O-].[K+].
What is the InChIKey of potassium 2-(1,3-dioxoisoindol-2-yl)ethanesulfonate?
The InChIKey is UHZPGGARCNRPBD-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H9NO5S.K/c12-9-7-3-1-2-4-8(7)10(13)11(9)5-6-17(14,15)16;/h1-4H,5-6H2,(H,14,15,16);/q;+1/p-1.
What are the key properties of potassium 2-(1,3-dioxoisoindol-2-yl)ethanesulfonate?
potassium 2-(1,3-dioxoisoindol-2-yl)ethanesulfonate has a molecular weight of 293.34 g/mol, XLogP of -3.17, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 2-(1,3-dioxoisoindol-2-yl)ethanesulfonate is sourced from PubChem (CID 22960477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).