About 2-(Cyclohexylthio)-1H-isoindole-1,3(2H)-dione
2-(Cyclohexylthio)-1H-isoindole-1,3(2H)-dione (PubChem CID 28777) has the molecular formula C14H15NO2S
and a molecular weight of 261.34 g/mol. Its IUPAC name is 2-cyclohexylsulfanylisoindole-1,3-dione.
Molecular Properties
| Compound Name | 2-(Cyclohexylthio)-1H-isoindole-1,3(2H)-dione |
| PubChem CID | 28777 |
| Molecular Formula | C14H15NO2S |
| Molecular Weight | 261.34 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 2-cyclohexylsulfanylisoindole-1,3-dione |
| SMILES | C1CCC(CC1)SN2C(=O)C3=CC=CC=C3C2=O |
| InChI | InChI=1S/C14H15NO2S/c16-13-11-8-4-5-9-12(11)14(17)15(13)18-10-6-2-1-3-7-10/h4-5,8-10H,1-3,6-7H2 |
| InChIKey | UEZWYKZHXASYJN-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | 328 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.34 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(Cyclohexylthio)-1H-isoindole-1,3(2H)-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(Cyclohexylthio)-1H-isoindole-1,3(2H)-dione?
The IUPAC name of 2-(Cyclohexylthio)-1H-isoindole-1,3(2H)-dione (CID 28777) is 2-cyclohexylsulfanylisoindole-1,3-dione.
What is the SMILES notation for 2-(Cyclohexylthio)-1H-isoindole-1,3(2H)-dione?
The canonical SMILES for 2-(Cyclohexylthio)-1H-isoindole-1,3(2H)-dione is C1CCC(CC1)SN2C(=O)C3=CC=CC=C3C2=O.
What is the InChIKey of 2-(Cyclohexylthio)-1H-isoindole-1,3(2H)-dione?
The InChIKey is UEZWYKZHXASYJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO2S/c16-13-11-8-4-5-9-12(11)14(17)15(13)18-10-6-2-1-3-7-10/h4-5,8-10H,1-3,6-7H2.
What are the key properties of 2-(Cyclohexylthio)-1H-isoindole-1,3(2H)-dione?
2-(Cyclohexylthio)-1H-isoindole-1,3(2H)-dione has a molecular weight of 261.34 g/mol, XLogP of 2.70, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(Cyclohexylthio)-1H-isoindole-1,3(2H)-dione is sourced from PubChem (CID 28777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).