C8H4ClNO4S — CID 15315536
1,3-dioxoisoindole-5-sulfonyl chloride (PubChem CID 15315536) has the molecular formula C8H4ClNO4S and a molecular weight of 245.64 g/mol. Its IUPAC name is 1,3-dioxoisoindole-5-sulfonyl chloride.
| Compound Name | 1,3-dioxoisoindole-5-sulfonyl chloride |
|---|---|
| PubChem CID | 15315536 |
| Molecular Formula | C8H4ClNO4S |
| Molecular Weight | 245.64 g/mol |
| Exact Mass | 244.95 |
| IUPAC Name | 1,3-dioxoisoindole-5-sulfonyl chloride |
| SMILES | O=C1NC(=O)c2cc(S(=O)(=O)Cl)ccc21 |
| InChI | InChI=1S/C8H4ClNO4S/c9-15(13,14)4-1-2-5-6(3-4)8(12)10-7(5)11/h1-3H,(H,10,11,12) |
| InChIKey | SUEUJJPJLQOTBB-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.64 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|