C12H8N2O2 — CID 11148545
2-[(1,3-dioxoisoindol-2-yl)methyl]prop-2-enenitrile (PubChem CID 11148545) has the molecular formula C12H8N2O2 and a molecular weight of 212.21 g/mol. Its IUPAC name is 2-[(1,3-dioxoisoindol-2-yl)methyl]prop-2-enenitrile.
| Compound Name | 2-[(1,3-dioxoisoindol-2-yl)methyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 11148545 |
| Molecular Formula | C12H8N2O2 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | 2-[(1,3-dioxoisoindol-2-yl)methyl]prop-2-enenitrile |
| SMILES | C=C(C#N)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C12H8N2O2/c1-8(6-13)7-14-11(15)9-4-2-3-5-10(9)12(14)16/h2-5H,1,7H2 |
| InChIKey | UWFJLRFSMPQFDG-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|