C25H24O2 — CID 144795099
(2E,4E)-5-[9-[(3Z)-5-hydroxyhexa-1,3,5-trien-2-yl]fluoren-9-yl]hexa-2,4-dien-2-ol (PubChem CID 144795099) has the molecular formula C25H24O2 and a molecular weight of 356.47 g/mol. Its IUPAC name is (2E,4E)-5-[9-[(3Z)-5-hydroxyhexa-1,3,5-trien-2-yl]fluoren-9-yl]hexa-2,4-dien-2-ol.
| Compound Name | (2E,4E)-5-[9-[(3Z)-5-hydroxyhexa-1,3,5-trien-2-yl]fluoren-9-yl]hexa-2,4-dien-2-ol |
|---|---|
| PubChem CID | 144795099 |
| Molecular Formula | C25H24O2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | (2E,4E)-5-[9-[(3Z)-5-hydroxyhexa-1,3,5-trien-2-yl]fluoren-9-yl]hexa-2,4-dien-2-ol |
| SMILES | C=C(O)/C=C\C(=C)C1(/C(C)=C/C=C(\C)O)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C25H24O2/c1-17(13-15-19(3)26)25(18(2)14-16-20(4)27)23-11-7-5-9-21(23)22-10-6-8-12-24(22)25/h5-16,26-27H,1,3H2,2,4H3/b15-13-,18-14+,20-16+ |
| InChIKey | NRQZTNSTYSYMDU-UDFNFBFJSA-N |
| XLogP | 6.55 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|