C33H34 — CID 167484417
9-[(2E,4Z)-hexa-2,4-dien-3-yl]-9-[(2E,4Z)-6-methylhepta-2,4-dien-3-yl]-2-phenylfluorene (PubChem CID 167484417) has the molecular formula C33H34 and a molecular weight of 430.64 g/mol. Its IUPAC name is 9-[(2E,4Z)-hexa-2,4-dien-3-yl]-9-[(2E,4Z)-6-methylhepta-2,4-dien-3-yl]-2-phenylfluorene.
| Compound Name | 9-[(2E,4Z)-hexa-2,4-dien-3-yl]-9-[(2E,4Z)-6-methylhepta-2,4-dien-3-yl]-2-phenylfluorene |
|---|---|
| PubChem CID | 167484417 |
| Molecular Formula | C33H34 |
| Molecular Weight | 430.64 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | 9-[(2E,4Z)-hexa-2,4-dien-3-yl]-9-[(2E,4Z)-6-methylhepta-2,4-dien-3-yl]-2-phenylfluorene |
| SMILES | C/C=C\C(=C/C)C1(C(/C=C\C(C)C)=C/C)c2ccccc2-c2ccc(-c3ccccc3)cc21 |
| InChI | InChI=1S/C33H34/c1-6-14-27(7-2)33(28(8-3)21-19-24(4)5)31-18-13-12-17-29(31)30-22-20-26(23-32(30)33)25-15-10-9-11-16-25/h6-24H,1-5H3/b14-6-,21-19-,27-7+,28-8+ |
| InChIKey | RLHMZHALCUCXIV-FBXXETMESA-N |
| XLogP | 9.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.64 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|