C66H49N3 — CID 144805599
2-(3,5-diphenylphenyl)-4-[3-[(2Z,4E)-6-methylhepta-2,4-dien-4-yl]-5-phenylphenyl]-6-(9,9'-spirobi[fluorene]-2-yl)-1,3,5-triazine (PubChem CID 144805599) has the molecular formula C66H49N3 and a molecular weight of 884.14 g/mol. Its IUPAC name is 2-(3,5-diphenylphenyl)-4-[3-[(2Z,4E)-6-methylhepta-2,4-dien-4-yl]-5-phenylphenyl]-6-(9,9'-spirobi[fluorene]-2-yl)-1,3,5-triazine.
| Compound Name | 2-(3,5-diphenylphenyl)-4-[3-[(2Z,4E)-6-methylhepta-2,4-dien-4-yl]-5-phenylphenyl]-6-(9,9'-spirobi[fluorene]-2-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 144805599 |
| Molecular Formula | C66H49N3 |
| Molecular Weight | 884.14 g/mol |
| Exact Mass | 883.39 |
| IUPAC Name | 2-(3,5-diphenylphenyl)-4-[3-[(2Z,4E)-6-methylhepta-2,4-dien-4-yl]-5-phenylphenyl]-6-(9,9'-spirobi[fluorene]-2-yl)-1,3,5-triazine |
| SMILES | C/C=C\C(=C/C(C)C)c1cc(-c2ccccc2)cc(-c2nc(-c3cc(-c4ccccc4)cc(-c4ccccc4)c3)nc(-c3ccc4c(c3)C3(c5ccccc5-c5ccccc53)c3ccccc3-4)n2)c1 |
| InChI | InChI=1S/C66H49N3/c1-4-20-47(35-43(2)3)52-37-51(46-25-12-7-13-26-46)40-54(41-52)65-68-63(67-64(69-65)53-38-49(44-21-8-5-9-22-44)36-50(39-53)45-23-10-6-11-24-45)48-33-34-58-57-29-16-19-32-61(57)66(62(58)42-48)59-30-17-14-27-55(59)56-28-15-18-31-60(56)66/h4-43H,1-3H3/b20-4-,47-35+ |
| InChIKey | URAZTDCRVOQMAB-WIQFRHAESA-N |
| XLogP | 16.83 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 884.14 |
| LogP ≤ 5 | 16.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|