C11H19BrO5S — CID 160533042
2-bromophenol;propane-1,2,3-triol;2-sulfanylethanol (PubChem CID 160533042) has the molecular formula C11H19BrO5S and a molecular weight of 343.24 g/mol. Its IUPAC name is 2-bromophenol;propane-1,2,3-triol;2-sulfanylethanol.
| Compound Name | 2-bromophenol;propane-1,2,3-triol;2-sulfanylethanol |
|---|---|
| PubChem CID | 160533042 |
| Molecular Formula | C11H19BrO5S |
| Molecular Weight | 343.24 g/mol |
| Exact Mass | 342.01 |
| IUPAC Name | 2-bromophenol;propane-1,2,3-triol;2-sulfanylethanol |
| SMILES | OCC(O)CO.OCCS.Oc1ccccc1Br |
| InChI | InChI=1S/C6H5BrO.C3H8O3.C2H6OS/c7-5-3-1-2-4-6(5)8;4-1-3(6)2-5;3-1-2-4/h1-4,8H;3-6H,1-2H2;3-4H,1-2H2 |
| InChIKey | QVULLOHMKSMCOH-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.24 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|