C11H15BrO2 — CID 83926043
4-(3-bromo-2-methylphenyl)butane-1,2-diol (PubChem CID 83926043) has the molecular formula C11H15BrO2 and a molecular weight of 259.14 g/mol. Its IUPAC name is 4-(3-bromo-2-methylphenyl)butane-1,2-diol.
| Compound Name | 4-(3-bromo-2-methylphenyl)butane-1,2-diol |
|---|---|
| PubChem CID | 83926043 |
| Molecular Formula | C11H15BrO2 |
| Molecular Weight | 259.14 g/mol |
| Exact Mass | 258.03 |
| IUPAC Name | 4-(3-bromo-2-methylphenyl)butane-1,2-diol |
| SMILES | Cc1c(Br)cccc1CCC(O)CO |
| InChI | InChI=1S/C11H15BrO2/c1-8-9(3-2-4-11(8)12)5-6-10(14)7-13/h2-4,10,13-14H,5-7H2,1H3 |
| InChIKey | QMWKEOLWWHKPBQ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.14 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |