C13H19BrO2 — CID 83924175
1-(2-bromophenyl)heptane-3,4-diol (PubChem CID 83924175) has the molecular formula C13H19BrO2 and a molecular weight of 287.20 g/mol. Its IUPAC name is 1-(2-bromophenyl)heptane-3,4-diol.
| Compound Name | 1-(2-bromophenyl)heptane-3,4-diol |
|---|---|
| PubChem CID | 83924175 |
| Molecular Formula | C13H19BrO2 |
| Molecular Weight | 287.20 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 1-(2-bromophenyl)heptane-3,4-diol |
| SMILES | CCCC(O)C(O)CCc1ccccc1Br |
| InChI | InChI=1S/C13H19BrO2/c1-2-5-12(15)13(16)9-8-10-6-3-4-7-11(10)14/h3-4,6-7,12-13,15-16H,2,5,8-9H2,1H3 |
| InChIKey | ZHXZJWXJYBCVDE-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.20 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |