About 1-bromo-2-propylbenzene;formaldehyde
1-bromo-2-propylbenzene;formaldehyde (PubChem CID 174375700) has the molecular formula C10H13BrO
and a molecular weight of 229.12 g/mol. Its IUPAC name is 1-bromo-2-propylbenzene;formaldehyde.
Molecular Properties
| Compound Name | 1-bromo-2-propylbenzene;formaldehyde |
| PubChem CID | 174375700 |
| Molecular Formula | C10H13BrO |
| Molecular Weight | 229.12 g/mol |
| Exact Mass | 228.01 |
| IUPAC Name | 1-bromo-2-propylbenzene;formaldehyde |
| SMILES | C=O.CCCc1ccccc1Br |
| InChI | InChI=1S/C9H11Br.CH2O/c1-2-5-8-6-3-4-7-9(8)10;1-2/h3-4,6-7H,2,5H2,1H3;1H2 |
| InChIKey | RKCRQHRRORJZIJ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.12 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-bromo-2-propylbenzene;formaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-2-propylbenzene;formaldehyde?
The IUPAC name of 1-bromo-2-propylbenzene;formaldehyde (CID 174375700) is 1-bromo-2-propylbenzene;formaldehyde.
What is the SMILES notation for 1-bromo-2-propylbenzene;formaldehyde?
The canonical SMILES for 1-bromo-2-propylbenzene;formaldehyde is C=O.CCCc1ccccc1Br.
What is the InChIKey of 1-bromo-2-propylbenzene;formaldehyde?
The InChIKey is RKCRQHRRORJZIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11Br.CH2O/c1-2-5-8-6-3-4-7-9(8)10;1-2/h3-4,6-7H,2,5H2,1H3;1H2.
What are the key properties of 1-bromo-2-propylbenzene;formaldehyde?
1-bromo-2-propylbenzene;formaldehyde has a molecular weight of 229.12 g/mol, XLogP of 3.22, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-2-propylbenzene;formaldehyde is sourced from PubChem (CID 174375700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).