C19H22O3 — CID 121455480
[(1E,3E)-4-phenylbuta-1,3-dienyl]benzene;propane-1,2,3-triol (PubChem CID 121455480) has the molecular formula C19H22O3 and a molecular weight of 298.38 g/mol. Its IUPAC name is [(1E,3E)-4-phenylbuta-1,3-dienyl]benzene;propane-1,2,3-triol.
| Compound Name | [(1E,3E)-4-phenylbuta-1,3-dienyl]benzene;propane-1,2,3-triol |
|---|---|
| PubChem CID | 121455480 |
| Molecular Formula | C19H22O3 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | [(1E,3E)-4-phenylbuta-1,3-dienyl]benzene;propane-1,2,3-triol |
| SMILES | C(/C=C/c1ccccc1)=C\c1ccccc1.OCC(O)CO |
| InChI | InChI=1S/C16H14.C3H8O3/c1-3-9-15(10-4-1)13-7-8-14-16-11-5-2-6-12-16;4-1-3(6)2-5/h1-14H;3-6H,1-2H2/b13-7+,14-8+; |
| InChIKey | BOPFFGKEOQBXHJ-IOJPAMHKSA-N |
| XLogP | 2.75 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|