(4E,6E)-3-hydroxy-7-phenylhepta-4,6-dienoic acid

C13H14O3 — CID 23428026

IUPAC(4E,6E)-3-hydroxy-7-phenylhepta-4,6-dienoic acid
SMILESO=C(O)CC(O)/C=C/C=C/c1ccccc1
InChIInChI=1S/C13H14O3/c14-12(10-13(15)16)9-5-4-8-11-6-2-1-3-7-11/h1-9,12,14H,10H2,(H,15,16)/b8-4+,9-5+
InChIKeyOSPMYBMOVIBYNI-KBXRYBNXSA-N
MW218.25 g/mol
LogP2.09
Rot. Bonds5

About (4E,6E)-3-hydroxy-7-phenylhepta-4,6-dienoic acid

(4E,6E)-3-hydroxy-7-phenylhepta-4,6-dienoic acid (PubChem CID 23428026) has the molecular formula C13H14O3 and a molecular weight of 218.25 g/mol. Its IUPAC name is (4E,6E)-3-hydroxy-7-phenylhepta-4,6-dienoic acid.

Molecular Properties

Compound Name(4E,6E)-3-hydroxy-7-phenylhepta-4,6-dienoic acid
PubChem CID23428026
Molecular FormulaC13H14O3
Molecular Weight218.25 g/mol
Exact Mass218.09
IUPAC Name(4E,6E)-3-hydroxy-7-phenylhepta-4,6-dienoic acid
SMILESO=C(O)CC(O)/C=C/C=C/c1ccccc1
InChIInChI=1S/C13H14O3/c14-12(10-13(15)16)9-5-4-8-11-6-2-1-3-7-11/h1-9,12,14H,10H2,(H,15,16)/b8-4+,9-5+
InChIKeyOSPMYBMOVIBYNI-KBXRYBNXSA-N
XLogP2.09
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500218.25
LogP ≤ 52.09
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze (4E,6E)-3-hydroxy-7-phenylhepta-4,6-dienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4E,6E)-3-hydroxy-7-phenylhepta-4,6-dienoic acid?
The IUPAC name of (4E,6E)-3-hydroxy-7-phenylhepta-4,6-dienoic acid (CID 23428026) is (4E,6E)-3-hydroxy-7-phenylhepta-4,6-dienoic acid.
What is the SMILES notation for (4E,6E)-3-hydroxy-7-phenylhepta-4,6-dienoic acid?
The canonical SMILES for (4E,6E)-3-hydroxy-7-phenylhepta-4,6-dienoic acid is O=C(O)CC(O)/C=C/C=C/c1ccccc1.
What is the InChIKey of (4E,6E)-3-hydroxy-7-phenylhepta-4,6-dienoic acid?
The InChIKey is OSPMYBMOVIBYNI-KBXRYBNXSA-N. The full InChI is InChI=1S/C13H14O3/c14-12(10-13(15)16)9-5-4-8-11-6-2-1-3-7-11/h1-9,12,14H,10H2,(H,15,16)/b8-4+,9-5+.
What are the key properties of (4E,6E)-3-hydroxy-7-phenylhepta-4,6-dienoic acid?
(4E,6E)-3-hydroxy-7-phenylhepta-4,6-dienoic acid has a molecular weight of 218.25 g/mol, XLogP of 2.09, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4E,6E)-3-hydroxy-7-phenylhepta-4,6-dienoic acid is sourced from PubChem (CID 23428026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).