C24H22O — CID 155932979
(1S,2R,3Z,5E)-1,2,6-triphenylhexa-3,5-dien-1-ol (PubChem CID 155932979) has the molecular formula C24H22O and a molecular weight of 326.44 g/mol. Its IUPAC name is (1S,2R,3Z,5E)-1,2,6-triphenylhexa-3,5-dien-1-ol.
| Compound Name | (1S,2R,3Z,5E)-1,2,6-triphenylhexa-3,5-dien-1-ol |
|---|---|
| PubChem CID | 155932979 |
| Molecular Formula | C24H22O |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | (1S,2R,3Z,5E)-1,2,6-triphenylhexa-3,5-dien-1-ol |
| SMILES | O[C@H](c1ccccc1)[C@H](/C=C\C=C\c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H22O/c25-24(22-17-8-3-9-18-22)23(21-15-6-2-7-16-21)19-11-10-14-20-12-4-1-5-13-20/h1-19,23-25H/b14-10+,19-11-/t23-,24-/m1/s1 |
| InChIKey | GBLLXTGPZKNWSG-GONHLQIASA-N |
| XLogP | 5.77 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|