C18H18O — CID 73292123
(2Z,4E)-1-(3-methylphenyl)-5-phenylpenta-2,4-dien-1-ol (PubChem CID 73292123) has the molecular formula C18H18O and a molecular weight of 250.34 g/mol. Its IUPAC name is (2Z,4E)-1-(3-methylphenyl)-5-phenylpenta-2,4-dien-1-ol.
| Compound Name | (2Z,4E)-1-(3-methylphenyl)-5-phenylpenta-2,4-dien-1-ol |
|---|---|
| PubChem CID | 73292123 |
| Molecular Formula | C18H18O |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | (2Z,4E)-1-(3-methylphenyl)-5-phenylpenta-2,4-dien-1-ol |
| SMILES | Cc1cccc(C(O)/C=C\C=C\c2ccccc2)c1 |
| InChI | InChI=1S/C18H18O/c1-15-8-7-12-17(14-15)18(19)13-6-5-11-16-9-3-2-4-10-16/h2-14,18-19H,1H3/b11-5+,13-6- |
| InChIKey | GSOSPNKOKMPFIY-PDGPDOJCSA-N |
| XLogP | 4.30 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|