C18H17NO — CID 56640990
(2E,4E)-N-(3-methylphenyl)-5-phenylpenta-2,4-dienamide (PubChem CID 56640990) has the molecular formula C18H17NO and a molecular weight of 263.34 g/mol. Its IUPAC name is (2E,4E)-N-(3-methylphenyl)-5-phenylpenta-2,4-dienamide.
| Compound Name | (2E,4E)-N-(3-methylphenyl)-5-phenylpenta-2,4-dienamide |
|---|---|
| PubChem CID | 56640990 |
| Molecular Formula | C18H17NO |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | (2E,4E)-N-(3-methylphenyl)-5-phenylpenta-2,4-dienamide |
| SMILES | Cc1cccc(NC(=O)/C=C/C=C/c2ccccc2)c1 |
| InChI | InChI=1S/C18H17NO/c1-15-8-7-12-17(14-15)19-18(20)13-6-5-11-16-9-3-2-4-10-16/h2-14H,1H3,(H,19,20)/b11-5+,13-6+ |
| InChIKey | UPCJINNFXRDYFH-LRPJOWSMSA-N |
| XLogP | 4.20 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|