C17H15NO3 — CID 23263855
(2E,4E)-5-(4-nitrophenyl)-1-phenylpenta-2,4-dien-1-ol (PubChem CID 23263855) has the molecular formula C17H15NO3 and a molecular weight of 281.31 g/mol. Its IUPAC name is (2E,4E)-5-(4-nitrophenyl)-1-phenylpenta-2,4-dien-1-ol.
| Compound Name | (2E,4E)-5-(4-nitrophenyl)-1-phenylpenta-2,4-dien-1-ol |
|---|---|
| PubChem CID | 23263855 |
| Molecular Formula | C17H15NO3 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | (2E,4E)-5-(4-nitrophenyl)-1-phenylpenta-2,4-dien-1-ol |
| SMILES | O=[N+]([O-])c1ccc(/C=C/C=C/C(O)c2ccccc2)cc1 |
| InChI | InChI=1S/C17H15NO3/c19-17(15-7-2-1-3-8-15)9-5-4-6-14-10-12-16(13-11-14)18(20)21/h1-13,17,19H/b6-4+,9-5+ |
| InChIKey | NRNQVWNSMFDQQS-REZHQCRGSA-N |
| XLogP | 3.90 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|